C22H17Cl2N5O3 — CID 22543732
N'-(5-amino-6-naphthalen-2-yloxypyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 22543732) has the molecular formula C22H17Cl2N5O3 and a molecular weight of 470.32 g/mol. Its IUPAC name is N'-(5-amino-6-naphthalen-2-yloxypyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-(5-amino-6-naphthalen-2-yloxypyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 22543732 |
| Molecular Formula | C22H17Cl2N5O3 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N'-(5-amino-6-naphthalen-2-yloxypyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | Nc1c(NNC(=O)COc2ccc(Cl)cc2Cl)ncnc1Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H17Cl2N5O3/c23-15-6-8-18(17(24)10-15)31-11-19(30)28-29-21-20(25)22(27-12-26-21)32-16-7-5-13-3-1-2-4-14(13)9-16/h1-10,12H,11,25H2,(H,28,30)(H,26,27,29) |
| InChIKey | NYRWGISAYMFESW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|