C25H20ClF3N6O — CID 19152181
N'-[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 19152181) has the molecular formula C25H20ClF3N6O and a molecular weight of 512.92 g/mol. Its IUPAC name is N'-[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19152181 |
| Molecular Formula | C25H20ClF3N6O |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | N'-[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | Nc1c(NNC(=O)C(c2ccccc2)c2ccccc2)ncnc1Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H20ClF3N6O/c26-19-12-11-17(13-18(19)25(27,28)29)33-22-21(30)23(32-14-31-22)34-35-24(36)20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,20H,30H2,(H,35,36)(H2,31,32,33,34) |
| InChIKey | HUAQFOHOWQQVKQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|