C19H15ClF3N5O2 — CID 19146267
methyl 2-[[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate (PubChem CID 19146267) has the molecular formula C19H15ClF3N5O2 and a molecular weight of 437.81 g/mol. Its IUPAC name is methyl 2-[[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19146267 |
| Molecular Formula | C19H15ClF3N5O2 |
| Molecular Weight | 437.81 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | methyl 2-[[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(Nc2ccc(Cl)c(C(F)(F)F)c2)c1N |
| InChI | InChI=1S/C19H15ClF3N5O2/c1-30-18(29)11-4-2-3-5-14(11)28-17-15(24)16(25-9-26-17)27-10-6-7-13(20)12(8-10)19(21,22)23/h2-9H,24H2,1H3,(H2,25,26,27,28) |
| InChIKey | SGOZLNSWWQGFKJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.81 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |