C27H27N7O3 — CID 3706918
2-[[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]-N-naphthalen-2-ylacetamide (PubChem CID 3706918) has the molecular formula C27H27N7O3 and a molecular weight of 497.56 g/mol. Its IUPAC name is 2-[[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 3706918 |
| Molecular Formula | C27H27N7O3 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 2-[[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]-N-naphthalen-2-ylacetamide |
| SMILES | O=C(CNc1ncnc(N2CCN(Cc3ccccc3)CC2)c1[N+](=O)[O-])Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H27N7O3/c35-24(31-23-11-10-21-8-4-5-9-22(21)16-23)17-28-26-25(34(36)37)27(30-19-29-26)33-14-12-32(13-15-33)18-20-6-2-1-3-7-20/h1-11,16,19H,12-15,17-18H2,(H,31,35)(H,28,29,30) |
| InChIKey | KCMUWHPSIDSECK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|