C27H26N8O2 — CID 23491204
6-(4-benzylpiperazin-1-yl)-5-nitro-N-(4-phenyldiazenylphenyl)pyrimidin-4-amine (PubChem CID 23491204) has the molecular formula C27H26N8O2 and a molecular weight of 494.56 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-5-nitro-N-(4-phenyldiazenylphenyl)pyrimidin-4-amine.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-5-nitro-N-(4-phenyldiazenylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23491204 |
| Molecular Formula | C27H26N8O2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-5-nitro-N-(4-phenyldiazenylphenyl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(/N=N/c3ccccc3)cc2)ncnc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H26N8O2/c36-35(37)25-26(30-22-11-13-24(14-12-22)32-31-23-9-5-2-6-10-23)28-20-29-27(25)34-17-15-33(16-18-34)19-21-7-3-1-4-8-21/h1-14,20H,15-19H2,(H,28,29,30)/b32-31+ |
| InChIKey | LHNDLXVILCRCID-QNEJGDQOSA-N |
| XLogP | 5.87 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|