C18H22N6O2S — CID 3683116
3-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-1,3-thiazolidine (PubChem CID 3683116) has the molecular formula C18H22N6O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is 3-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-1,3-thiazolidine.
| Compound Name | 3-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 3683116 |
| Molecular Formula | C18H22N6O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-1,3-thiazolidine |
| SMILES | O=[N+]([O-])c1c(N2CCN(Cc3ccccc3)CC2)ncnc1N1CCSC1 |
| InChI | InChI=1S/C18H22N6O2S/c25-24(26)16-17(19-13-20-18(16)23-10-11-27-14-23)22-8-6-21(7-9-22)12-15-4-2-1-3-5-15/h1-5,13H,6-12,14H2 |
| InChIKey | OCLGEWNWDOPULZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|