C23H19N7O3 — CID 3806170
4-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxybenzene-1,2-dicarbonitrile (PubChem CID 3806170) has the molecular formula C23H19N7O3 and a molecular weight of 441.45 g/mol. Its IUPAC name is 4-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxybenzene-1,2-dicarbonitrile.
| Compound Name | 4-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 3806170 |
| Molecular Formula | C23H19N7O3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxybenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2ncnc(N3CCN(Cc4ccccc4)CC3)c2[N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C23H19N7O3/c24-13-18-6-7-20(12-19(18)14-25)33-23-21(30(31)32)22(26-16-27-23)29-10-8-28(9-11-29)15-17-4-2-1-3-5-17/h1-7,12,16H,8-11,15H2 |
| InChIKey | WOWYYUJSLYYUFU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 132.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|