C26H33N7O2 — CID 3336142
N-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-N'-ethyl-N'-(3-methylphenyl)ethane-1,2-diamine (PubChem CID 3336142) has the molecular formula C26H33N7O2 and a molecular weight of 475.60 g/mol. Its IUPAC name is N-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-N'-ethyl-N'-(3-methylphenyl)ethane-1,2-diamine.
| Compound Name | N-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-N'-ethyl-N'-(3-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 3336142 |
| Molecular Formula | C26H33N7O2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | N-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-N'-ethyl-N'-(3-methylphenyl)ethane-1,2-diamine |
| SMILES | CCN(CCNc1ncnc(N2CCN(Cc3ccccc3)CC2)c1[N+](=O)[O-])c1cccc(C)c1 |
| InChI | InChI=1S/C26H33N7O2/c1-3-31(23-11-7-8-21(2)18-23)13-12-27-25-24(33(34)35)26(29-20-28-25)32-16-14-30(15-17-32)19-22-9-5-4-6-10-22/h4-11,18,20H,3,12-17,19H2,1-2H3,(H,27,28,29) |
| InChIKey | HTYNYCODUOYVOO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|