C16H25N5O4 — CID 3859526
methyl 6-[(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)amino]hexanoate (PubChem CID 3859526) has the molecular formula C16H25N5O4 and a molecular weight of 351.41 g/mol. Its IUPAC name is methyl 6-[(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)amino]hexanoate.
| Compound Name | methyl 6-[(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)amino]hexanoate |
|---|---|
| PubChem CID | 3859526 |
| Molecular Formula | C16H25N5O4 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | methyl 6-[(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNc1ncnc(N2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N5O4/c1-25-13(22)8-4-2-5-9-17-15-14(21(23)24)16(19-12-18-15)20-10-6-3-7-11-20/h12H,2-11H2,1H3,(H,17,18,19) |
| InChIKey | QYWJTUDULCTFLF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|