C23H26ClN5O2 — CID 3763564
6-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-N-cyclopentyl-5-nitro-N-prop-2-enylpyrimidin-4-amine (PubChem CID 3763564) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is 6-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-N-cyclopentyl-5-nitro-N-prop-2-enylpyrimidin-4-amine.
| Compound Name | 6-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-N-cyclopentyl-5-nitro-N-prop-2-enylpyrimidin-4-amine |
|---|---|
| PubChem CID | 3763564 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 6-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-N-cyclopentyl-5-nitro-N-prop-2-enylpyrimidin-4-amine |
| SMILES | C=CCN(c1ncnc(N2CC=C(c3ccc(Cl)cc3)CC2)c1[N+](=O)[O-])C1CCCC1 |
| InChI | InChI=1S/C23H26ClN5O2/c1-2-13-28(20-5-3-4-6-20)23-21(29(30)31)22(25-16-26-23)27-14-11-18(12-15-27)17-7-9-19(24)10-8-17/h2,7-11,16,20H,1,3-6,12-15H2 |
| InChIKey | KTNZSMFXIVZAID-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|