C14H19N5 — CID 14256771
N-cyclohexyl-N-prop-2-enyl-1H-pyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 14256771) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is N-cyclohexyl-N-prop-2-enyl-1H-pyrazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | N-cyclohexyl-N-prop-2-enyl-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 14256771 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-cyclohexyl-N-prop-2-enyl-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | C=CCN(c1ncnc2[nH]ncc12)C1CCCCC1 |
| InChI | InChI=1S/C14H19N5/c1-2-8-19(11-6-4-3-5-7-11)14-12-9-17-18-13(12)15-10-16-14/h2,9-11H,1,3-8H2,(H,15,16,17,18) |
| InChIKey | BKYPRULDVHZAQA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|