C10H14N6 — CID 11535873
1-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine (PubChem CID 11535873) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine.
| Compound Name | 1-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 11535873 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine |
| SMILES | NC1CCN(c2ncnc3[nH]ncc23)CC1 |
| InChI | InChI=1S/C10H14N6/c11-7-1-3-16(4-2-7)10-8-5-14-15-9(8)12-6-13-10/h5-7H,1-4,11H2,(H,12,13,14,15) |
| InChIKey | CFHQYSKGGQEOCZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |