C22H22ClFN6O3 — CID 3826296
N-[2-(2-chlorophenoxy)ethyl]-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 3826296) has the molecular formula C22H22ClFN6O3 and a molecular weight of 472.91 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 3826296 |
| Molecular Formula | C22H22ClFN6O3 |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCCOc2ccccc2Cl)ncnc1N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H22ClFN6O3/c23-16-5-1-4-8-19(16)33-14-9-25-21-20(30(31)32)22(27-15-26-21)29-12-10-28(11-13-29)18-7-3-2-6-17(18)24/h1-8,15H,9-14H2,(H,25,26,27) |
| InChIKey | YNSQZGIAYFBNHU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|