C21H26FN7O3 — CID 3865579
1-[3-[[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 3865579) has the molecular formula C21H26FN7O3 and a molecular weight of 443.48 g/mol. Its IUPAC name is 1-[3-[[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 3865579 |
| Molecular Formula | C21H26FN7O3 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 1-[3-[[6-[4-(2-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1ncnc(N2CCN(c3ccccc3F)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26FN7O3/c22-16-5-1-2-6-17(16)26-11-13-28(14-12-26)21-19(29(31)32)20(24-15-25-21)23-8-4-10-27-9-3-7-18(27)30/h1-2,5-6,15H,3-4,7-14H2,(H,23,24,25) |
| InChIKey | GSPQGIUMUUUQLR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|