C26H29FN6O2 — CID 42878256
4-[4-(2-fluorophenyl)piperazin-1-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]phthalazine-1-carboxamide (PubChem CID 42878256) has the molecular formula C26H29FN6O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is 4-[4-(2-fluorophenyl)piperazin-1-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]phthalazine-1-carboxamide.
| Compound Name | 4-[4-(2-fluorophenyl)piperazin-1-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42878256 |
| Molecular Formula | C26H29FN6O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-[4-(2-fluorophenyl)piperazin-1-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]phthalazine-1-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1nnc(N2CCN(c3ccccc3F)CC2)c2ccccc12 |
| InChI | InChI=1S/C26H29FN6O2/c27-21-9-3-4-10-22(21)31-15-17-33(18-16-31)25-20-8-2-1-7-19(20)24(29-30-25)26(35)28-12-6-14-32-13-5-11-23(32)34/h1-4,7-10H,5-6,11-18H2,(H,28,35) |
| InChIKey | VAAMOATYBOCGNN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|