C22H28N6O2 — CID 117080691
N-[3-(2-oxopyrrolidin-1-yl)propyl]-6-(4-pyridin-2-ylpiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 117080691) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-6-(4-pyridin-2-ylpiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-6-(4-pyridin-2-ylpiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 117080691 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-6-(4-pyridin-2-ylpiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1cccc(N2CCN(c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C22H28N6O2/c29-21-9-4-12-28(21)13-5-11-24-22(30)18-6-3-8-20(25-18)27-16-14-26(15-17-27)19-7-1-2-10-23-19/h1-3,6-8,10H,4-5,9,11-17H2,(H,24,30) |
| InChIKey | RLAOJMCOHHUHKY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|