C26H24FN5O2 — CID 42690680
4-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-methoxyphenyl)phthalazine-1-carboxamide (PubChem CID 42690680) has the molecular formula C26H24FN5O2 and a molecular weight of 457.51 g/mol. Its IUPAC name is 4-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-methoxyphenyl)phthalazine-1-carboxamide.
| Compound Name | 4-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-methoxyphenyl)phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42690680 |
| Molecular Formula | C26H24FN5O2 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 4-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-methoxyphenyl)phthalazine-1-carboxamide |
| SMILES | COc1cccc(NC(=O)c2nnc(N3CCN(c4ccccc4F)CC3)c3ccccc23)c1 |
| InChI | InChI=1S/C26H24FN5O2/c1-34-19-8-6-7-18(17-19)28-26(33)24-20-9-2-3-10-21(20)25(30-29-24)32-15-13-31(14-16-32)23-12-5-4-11-22(23)27/h2-12,17H,13-16H2,1H3,(H,28,33) |
| InChIKey | WGKLMQCDMRDRTI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |