C27H26FN5O2 — CID 42690905
N-[(3-fluorophenyl)methyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]phthalazine-1-carboxamide (PubChem CID 42690905) has the molecular formula C27H26FN5O2 and a molecular weight of 471.54 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]phthalazine-1-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42690905 |
| Molecular Formula | C27H26FN5O2 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]phthalazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(c3nnc(C(=O)NCc4cccc(F)c4)c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C27H26FN5O2/c1-35-22-11-9-21(10-12-22)32-13-15-33(16-14-32)26-24-8-3-2-7-23(24)25(30-31-26)27(34)29-18-19-5-4-6-20(28)17-19/h2-12,17H,13-16,18H2,1H3,(H,29,34) |
| InChIKey | DCRIODHTUXKRFR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|