C24H30N6O2 — CID 42690891
N-[2-(dimethylamino)ethyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]phthalazine-1-carboxamide (PubChem CID 42690891) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]phthalazine-1-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42690891 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]phthalazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(c3nnc(C(=O)NCCN(C)C)c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C24H30N6O2/c1-28(2)13-12-25-24(31)22-20-6-4-5-7-21(20)23(27-26-22)30-16-14-29(15-17-30)18-8-10-19(32-3)11-9-18/h4-11H,12-17H2,1-3H3,(H,25,31) |
| InChIKey | WBFAODYTGALFAO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|