C24H28N6O3 — CID 42691125
4-[4-(3-methoxyphenyl)piperazin-1-yl]-N-morpholin-4-ylphthalazine-1-carboxamide (PubChem CID 42691125) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-[4-(3-methoxyphenyl)piperazin-1-yl]-N-morpholin-4-ylphthalazine-1-carboxamide.
| Compound Name | 4-[4-(3-methoxyphenyl)piperazin-1-yl]-N-morpholin-4-ylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42691125 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4-[4-(3-methoxyphenyl)piperazin-1-yl]-N-morpholin-4-ylphthalazine-1-carboxamide |
| SMILES | COc1cccc(N2CCN(c3nnc(C(=O)NN4CCOCC4)c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C24H28N6O3/c1-32-19-6-4-5-18(17-19)28-9-11-29(12-10-28)23-21-8-3-2-7-20(21)22(25-26-23)24(31)27-30-13-15-33-16-14-30/h2-8,17H,9-16H2,1H3,(H,27,31) |
| InChIKey | PMGSAFYXEKFJDU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |