C26H23F2N5O — CID 42691065
N-[(2-fluorophenyl)methyl]-4-[4-(4-fluorophenyl)piperazin-1-yl]phthalazine-1-carboxamide (PubChem CID 42691065) has the molecular formula C26H23F2N5O and a molecular weight of 459.50 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-4-[4-(4-fluorophenyl)piperazin-1-yl]phthalazine-1-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-4-[4-(4-fluorophenyl)piperazin-1-yl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 42691065 |
| Molecular Formula | C26H23F2N5O |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-4-[4-(4-fluorophenyl)piperazin-1-yl]phthalazine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1nnc(N2CCN(c3ccc(F)cc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C26H23F2N5O/c27-19-9-11-20(12-10-19)32-13-15-33(16-14-32)25-22-7-3-2-6-21(22)24(30-31-25)26(34)29-17-18-5-1-4-8-23(18)28/h1-12H,13-17H2,(H,29,34) |
| InChIKey | VCCXBQLYJSGFGU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |