C23H24FN5OS — CID 42691066
[4-[4-(4-fluorophenyl)piperazin-1-yl]phthalazin-1-yl]-thiomorpholin-4-ylmethanone (PubChem CID 42691066) has the molecular formula C23H24FN5OS and a molecular weight of 437.54 g/mol. Its IUPAC name is [4-[4-(4-fluorophenyl)piperazin-1-yl]phthalazin-1-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [4-[4-(4-fluorophenyl)piperazin-1-yl]phthalazin-1-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 42691066 |
| Molecular Formula | C23H24FN5OS |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | [4-[4-(4-fluorophenyl)piperazin-1-yl]phthalazin-1-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(c1nnc(N2CCN(c3ccc(F)cc3)CC2)c2ccccc12)N1CCSCC1 |
| InChI | InChI=1S/C23H24FN5OS/c24-17-5-7-18(8-6-17)27-9-11-28(12-10-27)22-20-4-2-1-3-19(20)21(25-26-22)23(30)29-13-15-31-16-14-29/h1-8H,9-16H2 |
| InChIKey | JOVKNZJRWJPXKH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |