C21H24N4O2S — CID 22525760
N-(1-adamantyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine (PubChem CID 22525760) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-(1-adamantyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine.
| Compound Name | N-(1-adamantyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22525760 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-(1-adamantyl)-6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccc(Sc2ncnc(NC34CC5CC(CC(C5)C3)C4)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-13-2-4-17(5-3-13)28-20-18(25(26)27)19(22-12-23-20)24-21-9-14-6-15(10-21)8-16(7-14)11-21/h2-5,12,14-16H,6-11H2,1H3,(H,22,23,24) |
| InChIKey | RUVRCHOTSULZGM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|