C20H22N6O2 — CID 22539636
N'-[5-amino-6-[benzyl(methyl)amino]pyrimidin-4-yl]-2-phenoxyacetohydrazide (PubChem CID 22539636) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is N'-[5-amino-6-[benzyl(methyl)amino]pyrimidin-4-yl]-2-phenoxyacetohydrazide.
| Compound Name | N'-[5-amino-6-[benzyl(methyl)amino]pyrimidin-4-yl]-2-phenoxyacetohydrazide |
|---|---|
| PubChem CID | 22539636 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N'-[5-amino-6-[benzyl(methyl)amino]pyrimidin-4-yl]-2-phenoxyacetohydrazide |
| SMILES | CN(Cc1ccccc1)c1ncnc(NNC(=O)COc2ccccc2)c1N |
| InChI | InChI=1S/C20H22N6O2/c1-26(12-15-8-4-2-5-9-15)20-18(21)19(22-14-23-20)25-24-17(27)13-28-16-10-6-3-7-11-16/h2-11,14H,12-13,21H2,1H3,(H,24,27)(H,22,23,25) |
| InChIKey | USBGEVXONTWZCL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|