C8H15N5O — CID 19135072
4-N-(2-methoxyethyl)-6-N-methylpyrimidine-4,5,6-triamine (PubChem CID 19135072) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-N-(2-methoxyethyl)-6-N-methylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(2-methoxyethyl)-6-N-methylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19135072 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 4-N-(2-methoxyethyl)-6-N-methylpyrimidine-4,5,6-triamine |
| SMILES | CNc1ncnc(NCCOC)c1N |
| InChI | InChI=1S/C8H15N5O/c1-10-7-6(9)8(13-5-12-7)11-3-4-14-2/h5H,3-4,9H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | XUTMDFHRHXEMHK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|