C7H14N6O — CID 19150351
6-hydrazinyl-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine (PubChem CID 19150351) has the molecular formula C7H14N6O and a molecular weight of 198.23 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine.
| Compound Name | 6-hydrazinyl-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19150351 |
| Molecular Formula | C7H14N6O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 6-hydrazinyl-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine |
| SMILES | COCCNc1ncnc(NN)c1N |
| InChI | InChI=1S/C7H14N6O/c1-14-3-2-10-6-5(8)7(13-9)12-4-11-6/h4H,2-3,8-9H2,1H3,(H2,10,11,12,13) |
| InChIKey | FACTVIRUWKCAGM-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|