C21H22N6O — CID 19147361
N'-[5-amino-6-(3,4-dihydro-2H-quinolin-1-yl)pyrimidin-4-yl]-2-phenylacetohydrazide (PubChem CID 19147361) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is N'-[5-amino-6-(3,4-dihydro-2H-quinolin-1-yl)pyrimidin-4-yl]-2-phenylacetohydrazide.
| Compound Name | N'-[5-amino-6-(3,4-dihydro-2H-quinolin-1-yl)pyrimidin-4-yl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 19147361 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N'-[5-amino-6-(3,4-dihydro-2H-quinolin-1-yl)pyrimidin-4-yl]-2-phenylacetohydrazide |
| SMILES | Nc1c(NNC(=O)Cc2ccccc2)ncnc1N1CCCc2ccccc21 |
| InChI | InChI=1S/C21H22N6O/c22-19-20(26-25-18(28)13-15-7-2-1-3-8-15)23-14-24-21(19)27-12-6-10-16-9-4-5-11-17(16)27/h1-5,7-9,11,14H,6,10,12-13,22H2,(H,25,28)(H,23,24,26) |
| InChIKey | BDYWLRQILYSCDO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|