C17H20N6O4 — CID 23481574
2-methyl-N'-[5-nitro-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]benzohydrazide (PubChem CID 23481574) has the molecular formula C17H20N6O4 and a molecular weight of 372.39 g/mol. Its IUPAC name is 2-methyl-N'-[5-nitro-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-methyl-N'-[5-nitro-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23481574 |
| Molecular Formula | C17H20N6O4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-methyl-N'-[5-nitro-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]benzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(NCC2CCCO2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N6O4/c1-11-5-2-3-7-13(11)17(24)22-21-16-14(23(25)26)15(19-10-20-16)18-9-12-6-4-8-27-12/h2-3,5,7,10,12H,4,6,8-9H2,1H3,(H,22,24)(H2,18,19,20,21) |
| InChIKey | ZQDMCYVKGIJIPL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|