C16H18ClN5O3 — CID 23481451
4-N-(3-chloro-4-methylphenyl)-5-nitro-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 23481451) has the molecular formula C16H18ClN5O3 and a molecular weight of 363.81 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methylphenyl)-5-nitro-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-methylphenyl)-5-nitro-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23481451 |
| Molecular Formula | C16H18ClN5O3 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-N-(3-chloro-4-methylphenyl)-5-nitro-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | Cc1ccc(Nc2ncnc(NCC3CCCO3)c2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H18ClN5O3/c1-10-4-5-11(7-13(10)17)21-16-14(22(23)24)15(19-9-20-16)18-8-12-3-2-6-25-12/h4-5,7,9,12H,2-3,6,8H2,1H3,(H2,18,19,20,21) |
| InChIKey | WBSZRPUYNDJYSE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|