C20H19N7O2S — CID 19150094
N'-[5-amino-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-4-yl]-4-methoxybenzohydrazide (PubChem CID 19150094) has the molecular formula C20H19N7O2S and a molecular weight of 421.49 g/mol. Its IUPAC name is N'-[5-amino-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-4-yl]-4-methoxybenzohydrazide.
| Compound Name | N'-[5-amino-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-4-yl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 19150094 |
| Molecular Formula | C20H19N7O2S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N'-[5-amino-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-4-yl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ncnc(Nc3nc4ccc(C)cc4s3)c2N)cc1 |
| InChI | InChI=1S/C20H19N7O2S/c1-11-3-8-14-15(9-11)30-20(24-14)25-17-16(21)18(23-10-22-17)26-27-19(28)12-4-6-13(29-2)7-5-12/h3-10H,21H2,1-2H3,(H,27,28)(H2,22,23,24,25,26) |
| InChIKey | NFFKEBGREMNBPA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|