C9H18N6 — CID 83027639
2-(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)-1,1-dimethylhydrazine (PubChem CID 83027639) has the molecular formula C9H18N6 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83027639 |
| Molecular Formula | C9H18N6 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)-1,1-dimethylhydrazine |
| SMILES | CC(C)c1c(NN)ncnc1NN(C)C |
| InChI | InChI=1S/C9H18N6/c1-6(2)7-8(13-10)11-5-12-9(7)14-15(3)4/h5-6H,10H2,1-4H3,(H2,11,12,13,14) |
| InChIKey | RYMJOHIMJUDKBE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|