C10H16F3N5 — CID 80899159
6-hydrazinyl-N-methyl-5-propan-2-yl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine (PubChem CID 80899159) has the molecular formula C10H16F3N5 and a molecular weight of 263.27 g/mol. Its IUPAC name is 6-hydrazinyl-N-methyl-5-propan-2-yl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-methyl-5-propan-2-yl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80899159 |
| Molecular Formula | C10H16F3N5 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 6-hydrazinyl-N-methyl-5-propan-2-yl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
| SMILES | CC(C)c1c(NN)ncnc1N(C)CC(F)(F)F |
| InChI | InChI=1S/C10H16F3N5/c1-6(2)7-8(17-14)15-5-16-9(7)18(3)4-10(11,12)13/h5-6H,4,14H2,1-3H3,(H,15,16,17) |
| InChIKey | ZCSRSLDWCFISPR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|