C15H19ClN4O — CID 82455263
6-butoxy-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5-diamine (PubChem CID 82455263) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 6-butoxy-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5-diamine.
| Compound Name | 6-butoxy-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82455263 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 6-butoxy-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5-diamine |
| SMILES | CCCCOc1ncnc(NCc2ccc(Cl)cc2)c1N |
| InChI | InChI=1S/C15H19ClN4O/c1-2-3-8-21-15-13(17)14(19-10-20-15)18-9-11-4-6-12(16)7-5-11/h4-7,10H,2-3,8-9,17H2,1H3,(H,18,19,20) |
| InChIKey | UWYSTNVRHJRKJW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|