C19H16N8O — CID 19141332
N'-[5-amino-6-[bis(cyanomethyl)amino]pyrimidin-4-yl]naphthalene-1-carbohydrazide (PubChem CID 19141332) has the molecular formula C19H16N8O and a molecular weight of 372.39 g/mol. Its IUPAC name is N'-[5-amino-6-[bis(cyanomethyl)amino]pyrimidin-4-yl]naphthalene-1-carbohydrazide.
| Compound Name | N'-[5-amino-6-[bis(cyanomethyl)amino]pyrimidin-4-yl]naphthalene-1-carbohydrazide |
|---|---|
| PubChem CID | 19141332 |
| Molecular Formula | C19H16N8O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N'-[5-amino-6-[bis(cyanomethyl)amino]pyrimidin-4-yl]naphthalene-1-carbohydrazide |
| SMILES | N#CCN(CC#N)c1ncnc(NNC(=O)c2cccc3ccccc23)c1N |
| InChI | InChI=1S/C19H16N8O/c20-8-10-27(11-9-21)18-16(22)17(23-12-24-18)25-26-19(28)15-7-3-5-13-4-1-2-6-14(13)15/h1-7,12H,10-11,22H2,(H,26,28)(H,23,24,25) |
| InChIKey | AVVFNMZRHMRVIK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 143.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|