C22H19ClN6O — CID 22546682
N'-[5-amino-6-(3-chloro-4-methylanilino)pyrimidin-4-yl]naphthalene-1-carbohydrazide (PubChem CID 22546682) has the molecular formula C22H19ClN6O and a molecular weight of 418.89 g/mol. Its IUPAC name is N'-[5-amino-6-(3-chloro-4-methylanilino)pyrimidin-4-yl]naphthalene-1-carbohydrazide.
| Compound Name | N'-[5-amino-6-(3-chloro-4-methylanilino)pyrimidin-4-yl]naphthalene-1-carbohydrazide |
|---|---|
| PubChem CID | 22546682 |
| Molecular Formula | C22H19ClN6O |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N'-[5-amino-6-(3-chloro-4-methylanilino)pyrimidin-4-yl]naphthalene-1-carbohydrazide |
| SMILES | Cc1ccc(Nc2ncnc(NNC(=O)c3cccc4ccccc34)c2N)cc1Cl |
| InChI | InChI=1S/C22H19ClN6O/c1-13-9-10-15(11-18(13)23)27-20-19(24)21(26-12-25-20)28-29-22(30)17-8-4-6-14-5-2-3-7-16(14)17/h2-12H,24H2,1H3,(H,29,30)(H2,25,26,27,28) |
| InChIKey | SWMYLCOUAZFTMF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|