C16H21N5O2 — CID 19136754
methyl 2-[[5-amino-6-(diethylamino)pyrimidin-4-yl]amino]benzoate (PubChem CID 19136754) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is methyl 2-[[5-amino-6-(diethylamino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[5-amino-6-(diethylamino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19136754 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | methyl 2-[[5-amino-6-(diethylamino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCN(CC)c1ncnc(Nc2ccccc2C(=O)OC)c1N |
| InChI | InChI=1S/C16H21N5O2/c1-4-21(5-2)15-13(17)14(18-10-19-15)20-12-9-7-6-8-11(12)16(22)23-3/h6-10H,4-5,17H2,1-3H3,(H,18,19,20) |
| InChIKey | SVXDOJQNWBTQRV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |