C16H14N4O2 — CID 56689510
ethyl 2-(pyrido[2,3-d]pyrimidin-4-ylamino)benzoate (PubChem CID 56689510) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is ethyl 2-(pyrido[2,3-d]pyrimidin-4-ylamino)benzoate.
| Compound Name | ethyl 2-(pyrido[2,3-d]pyrimidin-4-ylamino)benzoate |
|---|---|
| PubChem CID | 56689510 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | ethyl 2-(pyrido[2,3-d]pyrimidin-4-ylamino)benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc2ncccc12 |
| InChI | InChI=1S/C16H14N4O2/c1-2-22-16(21)11-6-3-4-8-13(11)20-15-12-7-5-9-17-14(12)18-10-19-15/h3-10H,2H2,1H3,(H,17,18,19,20) |
| InChIKey | GCZCYCWIVSLDEZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |