C14H15N3O2 — CID 123452552
ethyl 2-[(2-amino-3-pyridinyl)amino]benzoate (PubChem CID 123452552) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is ethyl 2-[(2-amino-3-pyridinyl)amino]benzoate.
| Compound Name | ethyl 2-[(2-amino-3-pyridinyl)amino]benzoate |
|---|---|
| PubChem CID | 123452552 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | ethyl 2-[(2-amino-3-pyridinyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1cccnc1N |
| InChI | InChI=1S/C14H15N3O2/c1-2-19-14(18)10-6-3-4-7-11(10)17-12-8-5-9-16-13(12)15/h3-9,17H,2H2,1H3,(H2,15,16) |
| InChIKey | ANVYWWZOUSVOOO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |