C19H17N7O2 — CID 19154268
ethyl 2-[[5-amino-6-(benzotriazol-1-yl)pyrimidin-4-yl]amino]benzoate (PubChem CID 19154268) has the molecular formula C19H17N7O2 and a molecular weight of 375.39 g/mol. Its IUPAC name is ethyl 2-[[5-amino-6-(benzotriazol-1-yl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-amino-6-(benzotriazol-1-yl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19154268 |
| Molecular Formula | C19H17N7O2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | ethyl 2-[[5-amino-6-(benzotriazol-1-yl)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(-n2nnc3ccccc32)c1N |
| InChI | InChI=1S/C19H17N7O2/c1-2-28-19(27)12-7-3-4-8-13(12)23-17-16(20)18(22-11-21-17)26-15-10-6-5-9-14(15)24-25-26/h3-11H,2,20H2,1H3,(H,21,22,23) |
| InChIKey | VSECMZSIFQYQFL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |