C13H15N5O2 — CID 19137217
methyl 2-[(5,6-diaminopyrimidin-4-yl)-methylamino]benzoate (PubChem CID 19137217) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is methyl 2-[(5,6-diaminopyrimidin-4-yl)-methylamino]benzoate.
| Compound Name | methyl 2-[(5,6-diaminopyrimidin-4-yl)-methylamino]benzoate |
|---|---|
| PubChem CID | 19137217 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | methyl 2-[(5,6-diaminopyrimidin-4-yl)-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)c1ncnc(N)c1N |
| InChI | InChI=1S/C13H15N5O2/c1-18(12-10(14)11(15)16-7-17-12)9-6-4-3-5-8(9)13(19)20-2/h3-7H,14H2,1-2H3,(H2,15,16,17) |
| InChIKey | VMDNUHFMHYWEOG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |