C20H18N6O2 — CID 19154087
methyl 2-[[5-amino-6-(benzimidazol-1-yl)pyrimidin-4-yl]-methylamino]benzoate (PubChem CID 19154087) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is methyl 2-[[5-amino-6-(benzimidazol-1-yl)pyrimidin-4-yl]-methylamino]benzoate.
| Compound Name | methyl 2-[[5-amino-6-(benzimidazol-1-yl)pyrimidin-4-yl]-methylamino]benzoate |
|---|---|
| PubChem CID | 19154087 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | methyl 2-[[5-amino-6-(benzimidazol-1-yl)pyrimidin-4-yl]-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)c1ncnc(-n2cnc3ccccc32)c1N |
| InChI | InChI=1S/C20H18N6O2/c1-25(15-9-5-3-7-13(15)20(27)28-2)18-17(21)19(23-11-22-18)26-12-24-14-8-4-6-10-16(14)26/h3-12H,21H2,1-2H3 |
| InChIKey | ZUGOZWNQYUVFGW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |