C24H28N6O2 — CID 19139370
methyl 2-[[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-methylamino]benzoate (PubChem CID 19139370) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is methyl 2-[[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-methylamino]benzoate.
| Compound Name | methyl 2-[[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-methylamino]benzoate |
|---|---|
| PubChem CID | 19139370 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | methyl 2-[[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)c1ncnc(N2CCN(Cc3ccccc3)CC2)c1N |
| InChI | InChI=1S/C24H28N6O2/c1-28(20-11-7-6-10-19(20)24(31)32-2)22-21(25)23(27-17-26-22)30-14-12-29(13-15-30)16-18-8-4-3-5-9-18/h3-11,17H,12-16,25H2,1-2H3 |
| InChIKey | JXNQQMXBVBUSEQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |