C20H21N5O3 — CID 22543987
methyl 2-[[5-amino-6-(3-methoxyanilino)pyrimidin-4-yl]-methylamino]benzoate (PubChem CID 22543987) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is methyl 2-[[5-amino-6-(3-methoxyanilino)pyrimidin-4-yl]-methylamino]benzoate.
| Compound Name | methyl 2-[[5-amino-6-(3-methoxyanilino)pyrimidin-4-yl]-methylamino]benzoate |
|---|---|
| PubChem CID | 22543987 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | methyl 2-[[5-amino-6-(3-methoxyanilino)pyrimidin-4-yl]-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)c1ncnc(Nc2cccc(OC)c2)c1N |
| InChI | InChI=1S/C20H21N5O3/c1-25(16-10-5-4-9-15(16)20(26)28-3)19-17(21)18(22-12-23-19)24-13-7-6-8-14(11-13)27-2/h4-12H,21H2,1-3H3,(H,22,23,24) |
| InChIKey | BLEHMBAGZOYLJP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |