C19H25N5O3 — CID 23489348
N-(4-butoxyphenyl)-5-nitro-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 23489348) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-5-nitro-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-(4-butoxyphenyl)-5-nitro-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23489348 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-(4-butoxyphenyl)-5-nitro-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | CCCCOc1ccc(Nc2ncnc(N3CCCCC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H25N5O3/c1-2-3-13-27-16-9-7-15(8-10-16)22-18-17(24(25)26)19(21-14-20-18)23-11-5-4-6-12-23/h7-10,14H,2-6,11-13H2,1H3,(H,20,21,22) |
| InChIKey | LSGIJANUTWFWAC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|