C23H34N6O3 — CID 23495092
6-N-(4-butoxyphenyl)-5-nitro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine (PubChem CID 23495092) has the molecular formula C23H34N6O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 6-N-(4-butoxyphenyl)-5-nitro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-butoxyphenyl)-5-nitro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23495092 |
| Molecular Formula | C23H34N6O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 6-N-(4-butoxyphenyl)-5-nitro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,6-diamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(NC3CC(C)(C)NC(C)(C)C3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H34N6O3/c1-6-7-12-32-18-10-8-16(9-11-18)26-20-19(29(30)31)21(25-15-24-20)27-17-13-22(2,3)28-23(4,5)14-17/h8-11,15,17,28H,6-7,12-14H2,1-5H3,(H2,24,25,26,27) |
| InChIKey | CARHCXSOTURXPR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|