C21H28N8O5 — CID 22528417
2-(4-nitrophenyl)-N'-[5-nitro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]acetohydrazide (PubChem CID 22528417) has the molecular formula C21H28N8O5 and a molecular weight of 472.51 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N'-[5-nitro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]acetohydrazide.
| Compound Name | 2-(4-nitrophenyl)-N'-[5-nitro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 22528417 |
| Molecular Formula | C21H28N8O5 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-(4-nitrophenyl)-N'-[5-nitro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]acetohydrazide |
| SMILES | CC1(C)CC(Nc2ncnc(NNC(=O)Cc3ccc([N+](=O)[O-])cc3)c2[N+](=O)[O-])CC(C)(C)N1 |
| InChI | InChI=1S/C21H28N8O5/c1-20(2)10-14(11-21(3,4)27-20)24-18-17(29(33)34)19(23-12-22-18)26-25-16(30)9-13-5-7-15(8-6-13)28(31)32/h5-8,12,14,27H,9-11H2,1-4H3,(H,25,30)(H2,22,23,24,26) |
| InChIKey | SZEOZELEVAOKIS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|