C22H31N5O3 — CID 23490659
5-nitro-6-(4-propan-2-ylphenoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine (PubChem CID 23490659) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 5-nitro-6-(4-propan-2-ylphenoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine.
| Compound Name | 5-nitro-6-(4-propan-2-ylphenoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23490659 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 5-nitro-6-(4-propan-2-ylphenoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine |
| SMILES | CC(C)c1ccc(Oc2ncnc(NC3CC(C)(C)NC(C)(C)C3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H31N5O3/c1-14(2)15-7-9-17(10-8-15)30-20-18(27(28)29)19(23-13-24-20)25-16-11-21(3,4)26-22(5,6)12-16/h7-10,13-14,16,26H,11-12H2,1-6H3,(H,23,24,25) |
| InChIKey | WTFYJBAGBOYXCU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|