C17H22N4O4 — CID 23490772
N-(1-methoxypropan-2-yl)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-amine (PubChem CID 23490772) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-amine.
| Compound Name | N-(1-methoxypropan-2-yl)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23490772 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-amine |
| SMILES | COCC(C)Nc1ncnc(Oc2ccc(C(C)C)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N4O4/c1-11(2)13-5-7-14(8-6-13)25-17-15(21(22)23)16(18-10-19-17)20-12(3)9-24-4/h5-8,10-12H,9H2,1-4H3,(H,18,19,20) |
| InChIKey | SQCAIVADFAZMCT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|