C18H24N6O3 — CID 23490645
N-(4-methylpiperazin-1-yl)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-amine (PubChem CID 23490645) has the molecular formula C18H24N6O3 and a molecular weight of 372.43 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-amine.
| Compound Name | N-(4-methylpiperazin-1-yl)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23490645 |
| Molecular Formula | C18H24N6O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidin-4-amine |
| SMILES | CC(C)c1ccc(Oc2ncnc(NN3CCN(C)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H24N6O3/c1-13(2)14-4-6-15(7-5-14)27-18-16(24(25)26)17(19-12-20-18)21-23-10-8-22(3)9-11-23/h4-7,12-13H,8-11H2,1-3H3,(H,19,20,21) |
| InChIKey | OZSPFCOCLZZSFV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|