C21H21N3O4 — CID 23490782
4-(3,4-dimethylphenoxy)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidine (PubChem CID 23490782) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-(3,4-dimethylphenoxy)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidine.
| Compound Name | 4-(3,4-dimethylphenoxy)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidine |
|---|---|
| PubChem CID | 23490782 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-(3,4-dimethylphenoxy)-5-nitro-6-(4-propan-2-ylphenoxy)pyrimidine |
| SMILES | Cc1ccc(Oc2ncnc(Oc3ccc(C(C)C)cc3)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C21H21N3O4/c1-13(2)16-6-9-17(10-7-16)27-20-19(24(25)26)21(23-12-22-20)28-18-8-5-14(3)15(4)11-18/h5-13H,1-4H3 |
| InChIKey | SMQGZFGDPMEGRB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|